| ChemWhat Code |
Molecular Structure |
Product Information |
| 971066 |
 |
Formaldehyde, reaction products with hexahydro-1,3-isobenzofurandione and triethylenetetramine CAS#: 68478-68-2 |
| 970411 |
 |
5,7,7-trimethyl-6-oxa-3-azatricyclo(3.2.2.0)nonane CAS#: 68883-20-5 |
| 980779 |
 |
Acetamide, 2-[(8-ethyl-5-methyl-5H-1,2,4-triazino[5,6-b]indol-3-yl)thio]-N-(3-methylbutyl)- (9CI) CAS#: 603946-84-5 |
| 986788 |
 |
(2S)-2-PHENYL-1,2,3,4-TETRAHYDROQUINOLINE CAS#: 608525-26-4 |
| 994825 |
 |
2-Oxazolidinone,3-methyl-4-(1-methylethyl)-,(4S)-(9CI) CAS#: 677341-19-4 |
| 986206 |
 |
1-Propen-1-amine,N-1-propenyl-N-propyl-(9CI) CAS#: 625823-50-9 |
| 982921 |
 |
Thieno[2,3-b]quinoline-2-carboxamide, N-[2-(cyclohexylamino)-2-oxoethyl]-7-methyl-N-(4-methylphenyl)- (9CI) CAS#: 606114-88-9 |
| 993430 |
 |
2(1H)-Quinoxalinone, 5-hydroxy- CAS#: 659729-65-4 |
| 997705 |
 |
1,3,5-Trithiane-2-carboxamide,N-phenyl-(9CI) CAS#: 691375-42-5 |
| 992759 |
 |
1-Phenol-2-sulfonamide,5-amino-(5CI) CAS#: 647830-76-0 |